C18H17FN4O4 — CID 45001002
2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-nitrophenyl)-2-oxoacetamide (PubChem CID 45001002) has the molecular formula C18H17FN4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-nitrophenyl)-2-oxoacetamide.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-nitrophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 45001002 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(3-nitrophenyl)-2-oxoacetamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H17FN4O4/c19-15-6-1-2-7-16(15)21-8-10-22(11-9-21)18(25)17(24)20-13-4-3-5-14(12-13)23(26)27/h1-7,12H,8-11H2,(H,20,24) |
| InChIKey | UHBGDKRKQHWHOZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|