C24H23FN4O6 — CID 16822777
2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxy-N-(3-nitrophenyl)acetamide (PubChem CID 16822777) has the molecular formula C24H23FN4O6 and a molecular weight of 482.47 g/mol. Its IUPAC name is 2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxy-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxy-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16822777 |
| Molecular Formula | C24H23FN4O6 |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[6-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-4-oxopyran-3-yl]oxy-N-(3-nitrophenyl)acetamide |
| SMILES | O=C(COc1coc(CN2CCN(c3ccccc3F)CC2)cc1=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23FN4O6/c25-20-6-1-2-7-21(20)28-10-8-27(9-11-28)14-19-13-22(30)23(15-34-19)35-16-24(31)26-17-4-3-5-18(12-17)29(32)33/h1-7,12-13,15H,8-11,14,16H2,(H,26,31) |
| InChIKey | QAHHMABHFRNNKT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|