C24H21F2N3O5S — CID 11857190
[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]-[2-(4-fluorophenyl)-5-methylsulfonylphenyl]methanone (PubChem CID 11857190) has the molecular formula C24H21F2N3O5S and a molecular weight of 501.51 g/mol. Its IUPAC name is [4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]-[2-(4-fluorophenyl)-5-methylsulfonylphenyl]methanone.
| Compound Name | [4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]-[2-(4-fluorophenyl)-5-methylsulfonylphenyl]methanone |
|---|---|
| PubChem CID | 11857190 |
| Molecular Formula | C24H21F2N3O5S |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | [4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]-[2-(4-fluorophenyl)-5-methylsulfonylphenyl]methanone |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(F)cc2)c(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3F)CC2)c1 |
| InChI | InChI=1S/C24H21F2N3O5S/c1-35(33,34)19-7-8-20(16-2-4-17(25)5-3-16)21(15-19)24(30)28-12-10-27(11-13-28)23-9-6-18(29(31)32)14-22(23)26/h2-9,14-15H,10-13H2,1H3 |
| InChIKey | SQBPLCXMRBDZIH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|