C27H28F2N2O5S — CID 69248589
[4-[4-(1,3-dihydroxypropyl)-2-fluorophenyl]piperazin-1-yl]-[2-(4-fluorophenyl)-5-methylsulfonylphenyl]methanone (PubChem CID 69248589) has the molecular formula C27H28F2N2O5S and a molecular weight of 530.59 g/mol. Its IUPAC name is [4-[4-(1,3-dihydroxypropyl)-2-fluorophenyl]piperazin-1-yl]-[2-(4-fluorophenyl)-5-methylsulfonylphenyl]methanone.
| Compound Name | [4-[4-(1,3-dihydroxypropyl)-2-fluorophenyl]piperazin-1-yl]-[2-(4-fluorophenyl)-5-methylsulfonylphenyl]methanone |
|---|---|
| PubChem CID | 69248589 |
| Molecular Formula | C27H28F2N2O5S |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | [4-[4-(1,3-dihydroxypropyl)-2-fluorophenyl]piperazin-1-yl]-[2-(4-fluorophenyl)-5-methylsulfonylphenyl]methanone |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(F)cc2)c(C(=O)N2CCN(c3ccc(C(O)CCO)cc3F)CC2)c1 |
| InChI | InChI=1S/C27H28F2N2O5S/c1-37(35,36)21-7-8-22(18-2-5-20(28)6-3-18)23(17-21)27(34)31-13-11-30(12-14-31)25-9-4-19(16-24(25)29)26(33)10-15-32/h2-9,16-17,26,32-33H,10-15H2,1H3 |
| InChIKey | UXLHPCMOKLIMDJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|