C24H22FN3O5S — CID 11857189
[2-(4-fluorophenyl)-5-methylsulfonylphenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 11857189) has the molecular formula C24H22FN3O5S and a molecular weight of 483.52 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-5-methylsulfonylphenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(4-fluorophenyl)-5-methylsulfonylphenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 11857189 |
| Molecular Formula | C24H22FN3O5S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | [2-(4-fluorophenyl)-5-methylsulfonylphenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(F)cc2)c(C(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c1 |
| InChI | InChI=1S/C24H22FN3O5S/c1-34(32,33)21-10-11-22(17-2-4-18(25)5-3-17)23(16-21)24(29)27-14-12-26(13-15-27)19-6-8-20(9-7-19)28(30)31/h2-11,16H,12-15H2,1H3 |
| InChIKey | IECINHDJRKSWEV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|