C26H25F2N3O4S — CID 59822703
N-[3-fluoro-4-[4-[2-(4-fluorophenyl)-5-methylsulfonylbenzoyl]piperazin-1-yl]phenyl]acetamide (PubChem CID 59822703) has the molecular formula C26H25F2N3O4S and a molecular weight of 513.57 g/mol. Its IUPAC name is N-[3-fluoro-4-[4-[2-(4-fluorophenyl)-5-methylsulfonylbenzoyl]piperazin-1-yl]phenyl]acetamide.
| Compound Name | N-[3-fluoro-4-[4-[2-(4-fluorophenyl)-5-methylsulfonylbenzoyl]piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 59822703 |
| Molecular Formula | C26H25F2N3O4S |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N-[3-fluoro-4-[4-[2-(4-fluorophenyl)-5-methylsulfonylbenzoyl]piperazin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2CCN(C(=O)c3cc(S(C)(=O)=O)ccc3-c3ccc(F)cc3)CC2)c(F)c1 |
| InChI | InChI=1S/C26H25F2N3O4S/c1-17(32)29-20-7-10-25(24(28)15-20)30-11-13-31(14-12-30)26(33)23-16-21(36(2,34)35)8-9-22(23)18-3-5-19(27)6-4-18/h3-10,15-16H,11-14H2,1-2H3,(H,29,32) |
| InChIKey | GSDBULJGUKEBDE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|