C25H29FN4O4 — CID 141113102
1-[4-[4-[2-(azepan-2-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]ethanone (PubChem CID 141113102) has the molecular formula C25H29FN4O4 and a molecular weight of 468.53 g/mol. Its IUPAC name is 1-[4-[4-[2-(azepan-2-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]ethanone.
| Compound Name | 1-[4-[4-[2-(azepan-2-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 141113102 |
| Molecular Formula | C25H29FN4O4 |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 1-[4-[4-[2-(azepan-2-yl)-5-nitrobenzoyl]piperazin-1-yl]-3-fluorophenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3cc([N+](=O)[O-])ccc3C3CCCCCN3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H29FN4O4/c1-17(31)18-6-9-24(22(26)15-18)28-11-13-29(14-12-28)25(32)21-16-19(30(33)34)7-8-20(21)23-5-3-2-4-10-27-23/h6-9,15-16,23,27H,2-5,10-14H2,1H3 |
| InChIKey | RWRNURFMWGXBFE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|