C16H25N3O5S — CID 42893649
2-(2,6-dimethylmorpholin-4-yl)-N,N-diethyl-5-nitrobenzenesulfonamide (PubChem CID 42893649) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-N,N-diethyl-5-nitrobenzenesulfonamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-N,N-diethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 42893649 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-N,N-diethyl-5-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc([N+](=O)[O-])ccc1N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C16H25N3O5S/c1-5-18(6-2)25(22,23)16-9-14(19(20)21)7-8-15(16)17-10-12(3)24-13(4)11-17/h7-9,12-13H,5-6,10-11H2,1-4H3 |
| InChIKey | HDQQCGOTXLEQLS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|