C18H26N4O6S — CID 30206190
1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitrophenyl]piperidine-4-carboxamide (PubChem CID 30206190) has the molecular formula C18H26N4O6S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitrophenyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitrophenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30206190 |
| Molecular Formula | C18H26N4O6S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonyl-4-nitrophenyl]piperidine-4-carboxamide |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2N2CCC(C(N)=O)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H26N4O6S/c1-12-10-21(11-13(2)28-12)29(26,27)17-9-15(22(24)25)3-4-16(17)20-7-5-14(6-8-20)18(19)23/h3-4,9,12-14H,5-8,10-11H2,1-2H3,(H2,19,23)/t12-,13-/m0/s1 |
| InChIKey | YOZFEXUMQQFXEA-STQMWFEESA-N |
| XLogP | 1.09 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|