C18H24BrN3O4 — CID 133310814
[1-(2-bromo-4-nitrophenyl)piperidin-4-yl]-(2,6-dimethylmorpholin-4-yl)methanone (PubChem CID 133310814) has the molecular formula C18H24BrN3O4 and a molecular weight of 426.31 g/mol. Its IUPAC name is [1-(2-bromo-4-nitrophenyl)piperidin-4-yl]-(2,6-dimethylmorpholin-4-yl)methanone.
| Compound Name | [1-(2-bromo-4-nitrophenyl)piperidin-4-yl]-(2,6-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 133310814 |
| Molecular Formula | C18H24BrN3O4 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | [1-(2-bromo-4-nitrophenyl)piperidin-4-yl]-(2,6-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)C2CCN(c3ccc([N+](=O)[O-])cc3Br)CC2)CC(C)O1 |
| InChI | InChI=1S/C18H24BrN3O4/c1-12-10-21(11-13(2)26-12)18(23)14-5-7-20(8-6-14)17-4-3-15(22(24)25)9-16(17)19/h3-4,9,12-14H,5-8,10-11H2,1-2H3 |
| InChIKey | TZEJKFBZDGQBKS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|