C19H25N3O5 — CID 51942605
[(2S,6R)-2,6-dimethylmorpholin-4-yl]-[1-(3-nitrobenzoyl)piperidin-4-yl]methanone (PubChem CID 51942605) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is [(2S,6R)-2,6-dimethylmorpholin-4-yl]-[1-(3-nitrobenzoyl)piperidin-4-yl]methanone.
| Compound Name | [(2S,6R)-2,6-dimethylmorpholin-4-yl]-[1-(3-nitrobenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 51942605 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [(2S,6R)-2,6-dimethylmorpholin-4-yl]-[1-(3-nitrobenzoyl)piperidin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)C2CCN(C(=O)c3cccc([N+](=O)[O-])c3)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H25N3O5/c1-13-11-21(12-14(2)27-13)18(23)15-6-8-20(9-7-15)19(24)16-4-3-5-17(10-16)22(25)26/h3-5,10,13-15H,6-9,11-12H2,1-2H3/t13-,14+ |
| InChIKey | MJELTTUDHYBTCY-OKILXGFUSA-N |
| XLogP | 2.08 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|