C16H21N3O5 — CID 51147697
N-[1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 51147697) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-[1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 51147697 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[1-(2,6-dimethylmorpholin-4-yl)-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | CC1CN(C(=O)C(C)NC(=O)c2cccc([N+](=O)[O-])c2)CC(C)O1 |
| InChI | InChI=1S/C16H21N3O5/c1-10-8-18(9-11(2)24-10)16(21)12(3)17-15(20)13-5-4-6-14(7-13)19(22)23/h4-7,10-12H,8-9H2,1-3H3,(H,17,20) |
| InChIKey | LAAMRQSCOWJJSI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|