C20H23N5O4 — CID 9226398
3-nitro-N-[(2S)-1-oxo-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propan-2-yl]benzamide (PubChem CID 9226398) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 3-nitro-N-[(2S)-1-oxo-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propan-2-yl]benzamide.
| Compound Name | 3-nitro-N-[(2S)-1-oxo-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 9226398 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-nitro-N-[(2S)-1-oxo-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propan-2-yl]benzamide |
| SMILES | C[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C20H23N5O4/c1-15(22-19(26)17-3-2-4-18(13-17)25(28)29)20(27)24-11-9-23(10-12-24)14-16-5-7-21-8-6-16/h2-8,13,15H,9-12,14H2,1H3,(H,22,26)/t15-/m0/s1 |
| InChIKey | RNSTYGGAQSNAIE-HNNXBMFYSA-N |
| XLogP | 1.45 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|