C19H22N4O4S — CID 48733274
N-[1-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 48733274) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is N-[1-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 48733274 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[1-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cccs1)C(=O)N1CCN(Cc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H22N4O4S/c1-14(20-18(24)17-6-3-11-28-17)19(25)22-9-7-21(8-10-22)13-15-4-2-5-16(12-15)23(26)27/h2-6,11-12,14H,7-10,13H2,1H3,(H,20,24) |
| InChIKey | UVJAWDVNEYQCQP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|