C22H23F2N3O5S — CID 55827179
(2,5-difluorophenyl)-[1-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperidin-4-yl]methanone (PubChem CID 55827179) has the molecular formula C22H23F2N3O5S and a molecular weight of 479.51 g/mol. Its IUPAC name is (2,5-difluorophenyl)-[1-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperidin-4-yl]methanone.
| Compound Name | (2,5-difluorophenyl)-[1-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55827179 |
| Molecular Formula | C22H23F2N3O5S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | (2,5-difluorophenyl)-[1-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1F)C1CCN(c2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H23F2N3O5S/c23-16-3-5-19(24)18(13-16)22(28)15-7-11-25(12-8-15)20-6-4-17(27(29)30)14-21(20)33(31,32)26-9-1-2-10-26/h3-6,13-15H,1-2,7-12H2 |
| InChIKey | SJOCDJKIXCGNRH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|