C21H25FN4O4S — CID 87015937
1-(4-fluorophenyl)-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)-1,4-diazepane (PubChem CID 87015937) has the molecular formula C21H25FN4O4S and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)-1,4-diazepane.
| Compound Name | 1-(4-fluorophenyl)-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 87015937 |
| Molecular Formula | C21H25FN4O4S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)-1,4-diazepane |
| SMILES | O=[N+]([O-])c1ccc(N2CCCN(c3ccc(F)cc3)CC2)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H25FN4O4S/c22-17-4-6-18(7-5-17)23-10-3-11-24(15-14-23)20-9-8-19(26(27)28)16-21(20)31(29,30)25-12-1-2-13-25/h4-9,16H,1-3,10-15H2 |
| InChIKey | TWQOJNBHLWEEGX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|