C17H25N5O5S — CID 55377897
N-methyl-2-[4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperazin-1-yl]acetamide (PubChem CID 55377897) has the molecular formula C17H25N5O5S and a molecular weight of 411.48 g/mol. Its IUPAC name is N-methyl-2-[4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-methyl-2-[4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55377897 |
| Molecular Formula | C17H25N5O5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-methyl-2-[4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperazin-1-yl]acetamide |
| SMILES | CNC(=O)CN1CCN(c2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C17H25N5O5S/c1-18-17(23)13-19-8-10-20(11-9-19)15-5-4-14(22(24)25)12-16(15)28(26,27)21-6-2-3-7-21/h4-5,12H,2-3,6-11,13H2,1H3,(H,18,23) |
| InChIKey | NTRXNURXGUWCBK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|