C20H22ClN5O4 — CID 87020776
2-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]-N-methyl-5-nitrobenzamide (PubChem CID 87020776) has the molecular formula C20H22ClN5O4 and a molecular weight of 431.88 g/mol. Its IUPAC name is 2-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]-N-methyl-5-nitrobenzamide.
| Compound Name | 2-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]-N-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 87020776 |
| Molecular Formula | C20H22ClN5O4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-[4-[2-(2-chloroanilino)-2-oxoethyl]piperazin-1-yl]-N-methyl-5-nitrobenzamide |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])ccc1N1CCN(CC(=O)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H22ClN5O4/c1-22-20(28)15-12-14(26(29)30)6-7-18(15)25-10-8-24(9-11-25)13-19(27)23-17-5-3-2-4-16(17)21/h2-7,12H,8-11,13H2,1H3,(H,22,28)(H,23,27) |
| InChIKey | MEPJDCWUKAUGHC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|