C16H22ClN5O4 — CID 36888971
2-[4-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]piperazin-1-yl]-N-ethylacetamide (PubChem CID 36888971) has the molecular formula C16H22ClN5O4 and a molecular weight of 383.84 g/mol. Its IUPAC name is 2-[4-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]piperazin-1-yl]-N-ethylacetamide.
| Compound Name | 2-[4-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]piperazin-1-yl]-N-ethylacetamide |
|---|---|
| PubChem CID | 36888971 |
| Molecular Formula | C16H22ClN5O4 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[4-[2-(2-chloro-4-nitroanilino)-2-oxoethyl]piperazin-1-yl]-N-ethylacetamide |
| SMILES | CCNC(=O)CN1CCN(CC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)CC1 |
| InChI | InChI=1S/C16H22ClN5O4/c1-2-18-15(23)10-20-5-7-21(8-6-20)11-16(24)19-14-4-3-12(22(25)26)9-13(14)17/h3-4,9H,2,5-8,10-11H2,1H3,(H,18,23)(H,19,24) |
| InChIKey | DDFSWFBQCKRVER-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|