C18H18ClN5O5 — CID 27207371
N-(2-chloro-4-nitrophenyl)-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 27207371) has the molecular formula C18H18ClN5O5 and a molecular weight of 419.83 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 27207371 |
| Molecular Formula | C18H18ClN5O5 |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccccc2[N+](=O)[O-])CC1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H18ClN5O5/c19-14-11-13(23(26)27)5-6-15(14)20-18(25)12-21-7-9-22(10-8-21)16-3-1-2-4-17(16)24(28)29/h1-6,11H,7-10,12H2,(H,20,25) |
| InChIKey | RADQTDOEKOKYEB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|