C21H26N4O3 — CID 8582945
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 8582945) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 8582945 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CN1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C21H26N4O3/c1-15-5-4-6-20(17(15)3)24-11-9-23(10-12-24)14-21(26)22-19-13-18(25(27)28)8-7-16(19)2/h4-8,13H,9-12,14H2,1-3H3,(H,22,26) |
| InChIKey | IDUQRVHGOWCMFP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|