C21H23N5O3S — CID 17066546
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 17066546) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17066546 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1cccc(N2CCN(CC(=O)Nc3nc4ccc([N+](=O)[O-])cc4s3)CC2)c1C |
| InChI | InChI=1S/C21H23N5O3S/c1-14-4-3-5-18(15(14)2)25-10-8-24(9-11-25)13-20(27)23-21-22-17-7-6-16(26(28)29)12-19(17)30-21/h3-7,12H,8-11,13H2,1-2H3,(H,22,23,27) |
| InChIKey | LXLPZDFXEZYZSJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|