C18H17ClN6O3S — CID 78847003
N-(2-chloro-4-nitrophenyl)-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)acetamide (PubChem CID 78847003) has the molecular formula C18H17ClN6O3S and a molecular weight of 432.89 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)acetamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 78847003 |
| Molecular Formula | C18H17ClN6O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(c2ncnc3sccc23)CC1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H17ClN6O3S/c19-14-9-12(25(27)28)1-2-15(14)22-16(26)10-23-4-6-24(7-5-23)17-13-3-8-29-18(13)21-11-20-17/h1-3,8-9,11H,4-7,10H2,(H,22,26) |
| InChIKey | RBIUWGUQDHZJAJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|