C19H22BrN5O4S — CID 36833622
1-(5-bromo-2-pyridinyl)-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperazine (PubChem CID 36833622) has the molecular formula C19H22BrN5O4S and a molecular weight of 496.39 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperazine.
| Compound Name | 1-(5-bromo-2-pyridinyl)-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperazine |
|---|---|
| PubChem CID | 36833622 |
| Molecular Formula | C19H22BrN5O4S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-4-(4-nitro-2-pyrrolidin-1-ylsulfonylphenyl)piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(c3ccc(Br)cn3)CC2)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H22BrN5O4S/c20-15-3-6-19(21-14-15)23-11-9-22(10-12-23)17-5-4-16(25(26)27)13-18(17)30(28,29)24-7-1-2-8-24/h3-6,13-14H,1-2,7-12H2 |
| InChIKey | GODUMMOLVWFJKB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|