C18H20N4O4S — CID 30640158
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(5-nitro-2-pyridinyl)piperazine (PubChem CID 30640158) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(5-nitro-2-pyridinyl)piperazine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(5-nitro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 30640158 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(5-nitro-2-pyridinyl)piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(S(=O)(=O)c3ccc4c(c3)CCC4)CC2)nc1 |
| InChI | InChI=1S/C18H20N4O4S/c23-22(24)16-5-7-18(19-13-16)20-8-10-21(11-9-20)27(25,26)17-6-4-14-2-1-3-15(14)12-17/h4-7,12-13H,1-3,8-11H2 |
| InChIKey | CMFKJBGFWCTXFM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|