C20H27N7O4S — CID 46268139
2-methyl-4-(4-methylpiperazin-1-yl)-6-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 46268139) has the molecular formula C20H27N7O4S and a molecular weight of 461.55 g/mol. Its IUPAC name is 2-methyl-4-(4-methylpiperazin-1-yl)-6-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 2-methyl-4-(4-methylpiperazin-1-yl)-6-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 46268139 |
| Molecular Formula | C20H27N7O4S |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-methyl-4-(4-methylpiperazin-1-yl)-6-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | Cc1nc(N2CCN(C)CC2)cc(N2CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)n1 |
| InChI | InChI=1S/C20H27N7O4S/c1-16-21-19(24-9-7-23(2)8-10-24)15-20(22-16)25-11-13-26(14-12-25)32(30,31)18-5-3-17(4-6-18)27(28)29/h3-6,15H,7-14H2,1-2H3 |
| InChIKey | PUZOQDIKOPIMSO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 116.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|