C19H24N6O4S — CID 46268032
2-methyl-4-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-6-pyrrolidin-1-ylpyrimidine (PubChem CID 46268032) has the molecular formula C19H24N6O4S and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-methyl-4-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-6-pyrrolidin-1-ylpyrimidine.
| Compound Name | 2-methyl-4-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-6-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 46268032 |
| Molecular Formula | C19H24N6O4S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-methyl-4-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-6-pyrrolidin-1-ylpyrimidine |
| SMILES | Cc1nc(N2CCCC2)cc(N2CCN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC2)n1 |
| InChI | InChI=1S/C19H24N6O4S/c1-15-20-18(22-7-2-3-8-22)14-19(21-15)23-9-11-24(12-10-23)30(28,29)17-6-4-5-16(13-17)25(26)27/h4-6,13-14H,2-3,7-12H2,1H3 |
| InChIKey | ZFRSGDWCGWONDZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|