C20H23N7O4S — CID 121072535
4-(3,5-dimethylpyrazol-1-yl)-2-methyl-6-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 121072535) has the molecular formula C20H23N7O4S and a molecular weight of 457.52 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-2-methyl-6-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-2-methyl-6-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 121072535 |
| Molecular Formula | C20H23N7O4S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-2-methyl-6-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | Cc1cc(C)n(-c2cc(N3CCN(S(=O)(=O)c4cccc([N+](=O)[O-])c4)CC3)nc(C)n2)n1 |
| InChI | InChI=1S/C20H23N7O4S/c1-14-11-15(2)26(23-14)20-13-19(21-16(3)22-20)24-7-9-25(10-8-24)32(30,31)18-6-4-5-17(12-18)27(28)29/h4-6,11-13H,7-10H2,1-3H3 |
| InChIKey | JSGRSVNLQHYPCB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|