C20H22N8O6S — CID 121072521
4-(3,5-dimethylpyrazol-1-yl)-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 121072521) has the molecular formula C20H22N8O6S and a molecular weight of 502.51 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 121072521 |
| Molecular Formula | C20H22N8O6S |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-6-[4-(4-methyl-3,5-dinitrophenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | Cc1cc(C)n(-c2cc(N3CCN(S(=O)(=O)c4cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c4)CC3)ncn2)n1 |
| InChI | InChI=1S/C20H22N8O6S/c1-13-8-14(2)26(23-13)20-11-19(21-12-22-20)24-4-6-25(7-5-24)35(33,34)16-9-17(27(29)30)15(3)18(10-16)28(31)32/h8-12H,4-7H2,1-3H3 |
| InChIKey | JHEWGUYBALLZLE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 170.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|