C17H22N6O4S — CID 121032150
N,N,6-trimethyl-2-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidin-4-amine (PubChem CID 121032150) has the molecular formula C17H22N6O4S and a molecular weight of 406.47 g/mol. Its IUPAC name is N,N,6-trimethyl-2-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N,N,6-trimethyl-2-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 121032150 |
| Molecular Formula | C17H22N6O4S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N,N,6-trimethyl-2-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidin-4-amine |
| SMILES | Cc1cc(N(C)C)nc(N2CCN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC2)n1 |
| InChI | InChI=1S/C17H22N6O4S/c1-13-11-16(20(2)3)19-17(18-13)21-7-9-22(10-8-21)28(26,27)15-6-4-5-14(12-15)23(24)25/h4-6,11-12H,7-10H2,1-3H3 |
| InChIKey | FDLAUDGWGNRPTF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 112.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|