C20H23ClN6O6S — CID 11375674
6,7-dimethoxy-2-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]quinazolin-4-amine;hydrochloride (PubChem CID 11375674) has the molecular formula C20H23ClN6O6S and a molecular weight of 510.96 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]quinazolin-4-amine;hydrochloride.
| Compound Name | 6,7-dimethoxy-2-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 11375674 |
| Molecular Formula | C20H23ClN6O6S |
| Molecular Weight | 510.96 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 6,7-dimethoxy-2-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]quinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2nc(N3CCN(S(=O)(=O)c4cccc([N+](=O)[O-])c4)CC3)nc(N)c2cc1OC.Cl |
| InChI | InChI=1S/C20H22N6O6S.ClH/c1-31-17-11-15-16(12-18(17)32-2)22-20(23-19(15)21)24-6-8-25(9-7-24)33(29,30)14-5-3-4-13(10-14)26(27)28;/h3-5,10-12H,6-9H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | LXDIAZCIGMFDEN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 154.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.96 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|