C19H21N7O4S — CID 122345643
4-(4,5-dimethylimidazol-1-yl)-6-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine (PubChem CID 122345643) has the molecular formula C19H21N7O4S and a molecular weight of 443.49 g/mol. Its IUPAC name is 4-(4,5-dimethylimidazol-1-yl)-6-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine.
| Compound Name | 4-(4,5-dimethylimidazol-1-yl)-6-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 122345643 |
| Molecular Formula | C19H21N7O4S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 4-(4,5-dimethylimidazol-1-yl)-6-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]pyrimidine |
| SMILES | Cc1ncn(-c2cc(N3CCN(S(=O)(=O)c4cccc([N+](=O)[O-])c4)CC3)ncn2)c1C |
| InChI | InChI=1S/C19H21N7O4S/c1-14-15(2)25(13-22-14)19-11-18(20-12-21-19)23-6-8-24(9-7-23)31(29,30)17-5-3-4-16(10-17)26(27)28/h3-5,10-13H,6-9H2,1-2H3 |
| InChIKey | ICSYNOCQLWTRHP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|