C20H21N7O3 — CID 122345636
[4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 122345636) has the molecular formula C20H21N7O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is [4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 122345636 |
| Molecular Formula | C20H21N7O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [4-[6-(4,5-dimethylimidazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1ncn(-c2cc(N3CCN(C(=O)c4ccc([N+](=O)[O-])cc4)CC3)ncn2)c1C |
| InChI | InChI=1S/C20H21N7O3/c1-14-15(2)26(13-23-14)19-11-18(21-12-22-19)24-7-9-25(10-8-24)20(28)16-3-5-17(6-4-16)27(29)30/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | YRQHJRHGUKKPOP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|