C18H14F5NO3S — CID 71889854
(2,5-difluorophenyl)-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-4-yl]methanone (PubChem CID 71889854) has the molecular formula C18H14F5NO3S and a molecular weight of 419.37 g/mol. Its IUPAC name is (2,5-difluorophenyl)-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-4-yl]methanone.
| Compound Name | (2,5-difluorophenyl)-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 71889854 |
| Molecular Formula | C18H14F5NO3S |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | (2,5-difluorophenyl)-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-4-yl]methanone |
| SMILES | O=C(c1cc(F)ccc1F)C1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H14F5NO3S/c19-11-1-2-13(20)12(9-11)18(25)10-5-7-24(8-6-10)28(26,27)15-4-3-14(21)16(22)17(15)23/h1-4,9-10H,5-8H2 |
| InChIKey | OWNXACULQXLJFU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|