C11H13F3N2O2S — CID 43556384
1-(2,3,4-trifluorophenyl)sulfonylpiperidin-4-amine (PubChem CID 43556384) has the molecular formula C11H13F3N2O2S and a molecular weight of 294.30 g/mol. Its IUPAC name is 1-(2,3,4-trifluorophenyl)sulfonylpiperidin-4-amine.
| Compound Name | 1-(2,3,4-trifluorophenyl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 43556384 |
| Molecular Formula | C11H13F3N2O2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-(2,3,4-trifluorophenyl)sulfonylpiperidin-4-amine |
| SMILES | NC1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C11H13F3N2O2S/c12-8-1-2-9(11(14)10(8)13)19(17,18)16-5-3-7(15)4-6-16/h1-2,7H,3-6,15H2 |
| InChIKey | CCJYOHKDCLPKBP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|