C15H18F3NO2S — CID 11926596
(4aS,8aS)-2-(2,3,4-trifluorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 11926596) has the molecular formula C15H18F3NO2S and a molecular weight of 333.38 g/mol. Its IUPAC name is (4aS,8aS)-2-(2,3,4-trifluorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | (4aS,8aS)-2-(2,3,4-trifluorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 11926596 |
| Molecular Formula | C15H18F3NO2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (4aS,8aS)-2-(2,3,4-trifluorophenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1F)N1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C15H18F3NO2S/c16-12-5-6-13(15(18)14(12)17)22(20,21)19-8-7-10-3-1-2-4-11(10)9-19/h5-6,10-11H,1-4,7-9H2/t10-,11+/m0/s1 |
| InChIKey | AUFSKPUIHNEYEA-WDEREUQCSA-N |
| XLogP | 3.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|