C12H10F6N2O3S — CID 3425446
2,2,2-trifluoro-N-[1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-3-yl]acetamide (PubChem CID 3425446) has the molecular formula C12H10F6N2O3S and a molecular weight of 376.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3425446 |
| Molecular Formula | C12H10F6N2O3S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-3-yl]acetamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)C1)C(F)(F)F |
| InChI | InChI=1S/C12H10F6N2O3S/c13-7-1-2-8(10(15)9(7)14)24(22,23)20-4-3-6(5-20)19-11(21)12(16,17)18/h1-2,6H,3-5H2,(H,19,21) |
| InChIKey | NVOYHHCQOVBVOU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|