C12H11Cl2F3N2O4S — CID 134091455
N-[1-(3,5-dichloro-2-hydroxyphenyl)sulfonylpyrrolidin-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 134091455) has the molecular formula C12H11Cl2F3N2O4S and a molecular weight of 407.20 g/mol. Its IUPAC name is N-[1-(3,5-dichloro-2-hydroxyphenyl)sulfonylpyrrolidin-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-(3,5-dichloro-2-hydroxyphenyl)sulfonylpyrrolidin-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 134091455 |
| Molecular Formula | C12H11Cl2F3N2O4S |
| Molecular Weight | 407.20 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | N-[1-(3,5-dichloro-2-hydroxyphenyl)sulfonylpyrrolidin-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2cc(Cl)cc(Cl)c2O)C1)C(F)(F)F |
| InChI | InChI=1S/C12H11Cl2F3N2O4S/c13-6-3-8(14)10(20)9(4-6)24(22,23)19-2-1-7(5-19)18-11(21)12(15,16)17/h3-4,7,20H,1-2,5H2,(H,18,21) |
| InChIKey | GKWNRERYYCHWHX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|