C16H22Cl2N2O4S — CID 3743179
1-(3,5-dichloro-2-hydroxyphenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide (PubChem CID 3743179) has the molecular formula C16H22Cl2N2O4S and a molecular weight of 409.34 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-hydroxyphenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-(3,5-dichloro-2-hydroxyphenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3743179 |
| Molecular Formula | C16H22Cl2N2O4S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-(3,5-dichloro-2-hydroxyphenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(S(=O)(=O)c2cc(Cl)cc(Cl)c2O)C1 |
| InChI | InChI=1S/C16H22Cl2N2O4S/c1-3-19(4-2)16(22)11-6-5-7-20(10-11)25(23,24)14-9-12(17)8-13(18)15(14)21/h8-9,11,21H,3-7,10H2,1-2H3 |
| InChIKey | XJFFWJLRJGCJOM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|