C16H22ClFN2O3S — CID 3846784
1-(3-chloro-4-fluorophenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide (PubChem CID 3846784) has the molecular formula C16H22ClFN2O3S and a molecular weight of 376.88 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3846784 |
| Molecular Formula | C16H22ClFN2O3S |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(S(=O)(=O)c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H22ClFN2O3S/c1-3-19(4-2)16(21)12-6-5-9-20(11-12)24(22,23)13-7-8-15(18)14(17)10-13/h7-8,10,12H,3-6,9,11H2,1-2H3 |
| InChIKey | RFEXXVQWLILMJX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |