C16H16ClFN4O3S — CID 60612819
1-(3-chloro-4-fluorophenyl)sulfonyl-N,N-bis(cyanomethyl)piperidine-4-carboxamide (PubChem CID 60612819) has the molecular formula C16H16ClFN4O3S and a molecular weight of 398.85 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)sulfonyl-N,N-bis(cyanomethyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-N,N-bis(cyanomethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60612819 |
| Molecular Formula | C16H16ClFN4O3S |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)sulfonyl-N,N-bis(cyanomethyl)piperidine-4-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)C1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H16ClFN4O3S/c17-14-11-13(1-2-15(14)18)26(24,25)22-7-3-12(4-8-22)16(23)21(9-5-19)10-6-20/h1-2,11-12H,3-4,7-10H2 |
| InChIKey | IGJODXDIPPOHAH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 105.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|