C11H13ClFNO3S — CID 62372226
[1-(3-chloro-4-fluorophenyl)sulfonylpyrrolidin-3-yl]methanol (PubChem CID 62372226) has the molecular formula C11H13ClFNO3S and a molecular weight of 293.75 g/mol. Its IUPAC name is [1-(3-chloro-4-fluorophenyl)sulfonylpyrrolidin-3-yl]methanol.
| Compound Name | [1-(3-chloro-4-fluorophenyl)sulfonylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 62372226 |
| Molecular Formula | C11H13ClFNO3S |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | [1-(3-chloro-4-fluorophenyl)sulfonylpyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(c1ccc(F)c(Cl)c1)N1CCC(CO)C1 |
| InChI | InChI=1S/C11H13ClFNO3S/c12-10-5-9(1-2-11(10)13)18(16,17)14-4-3-8(6-14)7-15/h1-2,5,8,15H,3-4,6-7H2 |
| InChIKey | AGVLUJKYDOTYAU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |