C11H13Cl2NO3S — CID 62372743
[1-(3,5-dichlorophenyl)sulfonylpyrrolidin-3-yl]methanol (PubChem CID 62372743) has the molecular formula C11H13Cl2NO3S and a molecular weight of 310.20 g/mol. Its IUPAC name is [1-(3,5-dichlorophenyl)sulfonylpyrrolidin-3-yl]methanol.
| Compound Name | [1-(3,5-dichlorophenyl)sulfonylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 62372743 |
| Molecular Formula | C11H13Cl2NO3S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | [1-(3,5-dichlorophenyl)sulfonylpyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1)N1CCC(CO)C1 |
| InChI | InChI=1S/C11H13Cl2NO3S/c12-9-3-10(13)5-11(4-9)18(16,17)14-2-1-8(6-14)7-15/h3-5,8,15H,1-2,6-7H2 |
| InChIKey | ZRCHFRPTEQAKGU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |