C10H11Cl2NO4S — CID 79411225
(3R,4S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 79411225) has the molecular formula C10H11Cl2NO4S and a molecular weight of 312.17 g/mol. Its IUPAC name is (3R,4S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79411225 |
| Molecular Formula | C10H11Cl2NO4S |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | (3R,4S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H11Cl2NO4S/c11-6-1-7(12)3-8(2-6)18(16,17)13-4-9(14)10(15)5-13/h1-3,9-10,14-15H,4-5H2/t9-,10+ |
| InChIKey | GRGPZYYOGWIYJJ-AOOOYVTPSA-N |
| XLogP | 0.72 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |