C12H17ClN2O3S — CID 131891133
(3S,4S)-1-(3-chlorophenyl)sulfonyl-4-(dimethylamino)pyrrolidin-3-ol (PubChem CID 131891133) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is (3S,4S)-1-(3-chlorophenyl)sulfonyl-4-(dimethylamino)pyrrolidin-3-ol.
| Compound Name | (3S,4S)-1-(3-chlorophenyl)sulfonyl-4-(dimethylamino)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 131891133 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (3S,4S)-1-(3-chlorophenyl)sulfonyl-4-(dimethylamino)pyrrolidin-3-ol |
| SMILES | CN(C)[C@H]1CN(S(=O)(=O)c2cccc(Cl)c2)C[C@@H]1O |
| InChI | InChI=1S/C12H17ClN2O3S/c1-14(2)11-7-15(8-12(11)16)19(17,18)10-5-3-4-9(13)6-10/h3-6,11-12,16H,7-8H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | BZHXLYTURDJDTP-RYUDHWBXSA-N |
| XLogP | 0.64 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |