C13H17ClN2O2S — CID 133125721
(3S,4R)-1-(3-chlorophenyl)sulfonyl-4-cyclopropylpyrrolidin-3-amine (PubChem CID 133125721) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is (3S,4R)-1-(3-chlorophenyl)sulfonyl-4-cyclopropylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-(3-chlorophenyl)sulfonyl-4-cyclopropylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 133125721 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (3S,4R)-1-(3-chlorophenyl)sulfonyl-4-cyclopropylpyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(S(=O)(=O)c2cccc(Cl)c2)C[C@H]1C1CC1 |
| InChI | InChI=1S/C13H17ClN2O2S/c14-10-2-1-3-11(6-10)19(17,18)16-7-12(9-4-5-9)13(15)8-16/h1-3,6,9,12-13H,4-5,7-8,15H2/t12-,13+/m0/s1 |
| InChIKey | GHFPJOXPXZBIGG-QWHCGFSZSA-N |
| XLogP | 1.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |