C14H16Cl2N2O2S — CID 146532275
(1R,2S,6R,7S)-4-(3,5-dichlorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 146532275) has the molecular formula C14H16Cl2N2O2S and a molecular weight of 347.27 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-(3,5-dichlorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,6R,7S)-4-(3,5-dichlorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 146532275 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | (1R,2S,6R,7S)-4-(3,5-dichlorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1)N1C[C@@H]2[C@H](C1)[C@@H]1CC[C@H]2N1 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c15-8-3-9(16)5-10(4-8)21(19,20)18-6-11-12(7-18)14-2-1-13(11)17-14/h3-5,11-14,17H,1-2,6-7H2/t11-,12+,13-,14+ |
| InChIKey | IPZPYHHTXJPTCC-KPWCQOOUSA-N |
| XLogP | 2.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |