C17H17Cl2N5O3S — CID 135150585
[(1S,2R,6S,7R)-4-(3,5-dichlorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-(2H-triazol-4-yl)methanone (PubChem CID 135150585) has the molecular formula C17H17Cl2N5O3S and a molecular weight of 442.33 g/mol. Its IUPAC name is [(1S,2R,6S,7R)-4-(3,5-dichlorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [(1S,2R,6S,7R)-4-(3,5-dichlorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 135150585 |
| Molecular Formula | C17H17Cl2N5O3S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | [(1S,2R,6S,7R)-4-(3,5-dichlorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-(2H-triazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]n1)N1[C@@H]2CC[C@H]1[C@H]1CN(S(=O)(=O)c3cc(Cl)cc(Cl)c3)C[C@H]12 |
| InChI | InChI=1S/C17H17Cl2N5O3S/c18-9-3-10(19)5-11(4-9)28(26,27)23-7-12-13(8-23)16-2-1-15(12)24(16)17(25)14-6-20-22-21-14/h3-6,12-13,15-16H,1-2,7-8H2,(H,20,21,22)/t12-,13+,15-,16+ |
| InChIKey | HLWNWWWNDFAWIU-SDSIWUNFSA-N |
| XLogP | 2.04 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |