C17H18FN5O3S — CID 135150570
[(1S,2R,6S,7R)-4-(3-fluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-(2H-triazol-4-yl)methanone (PubChem CID 135150570) has the molecular formula C17H18FN5O3S and a molecular weight of 391.43 g/mol. Its IUPAC name is [(1S,2R,6S,7R)-4-(3-fluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [(1S,2R,6S,7R)-4-(3-fluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 135150570 |
| Molecular Formula | C17H18FN5O3S |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [(1S,2R,6S,7R)-4-(3-fluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]-(2H-triazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]n1)N1[C@@H]2CC[C@H]1[C@H]1CN(S(=O)(=O)c3cccc(F)c3)C[C@H]12 |
| InChI | InChI=1S/C17H18FN5O3S/c18-10-2-1-3-11(6-10)27(25,26)22-8-12-13(9-22)16-5-4-15(12)23(16)17(24)14-7-19-21-20-14/h1-3,6-7,12-13,15-16H,4-5,8-9H2,(H,19,20,21)/t12-,13+,15-,16+ |
| InChIKey | NBDPZPPNRSPXOT-SDSIWUNFSA-N |
| XLogP | 0.87 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |