C17H17ClN2O6S2 — CID 69116589
[1-[5-(benzenesulfonyl)-2-chlorophenyl]sulfonylpyrrolidin-3-yl]carbamic acid (PubChem CID 69116589) has the molecular formula C17H17ClN2O6S2 and a molecular weight of 444.92 g/mol. Its IUPAC name is [1-[5-(benzenesulfonyl)-2-chlorophenyl]sulfonylpyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[5-(benzenesulfonyl)-2-chlorophenyl]sulfonylpyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 69116589 |
| Molecular Formula | C17H17ClN2O6S2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | [1-[5-(benzenesulfonyl)-2-chlorophenyl]sulfonylpyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(S(=O)(=O)c2cc(S(=O)(=O)c3ccccc3)ccc2Cl)C1 |
| InChI | InChI=1S/C17H17ClN2O6S2/c18-15-7-6-14(27(23,24)13-4-2-1-3-5-13)10-16(15)28(25,26)20-9-8-12(11-20)19-17(21)22/h1-7,10,12,19H,8-9,11H2,(H,21,22) |
| InChIKey | UXUKEYFMKQOXCQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |